Vanillin (methyl vanillin) is used in flavorings, fragrances,
pharmaceuticals, and perfumes. It is closely related to
ethyl vanillin, a slightly
larger molecule.
Because it does not have quite the same taste as the much more
complex mixture of compounds found in natural vanilla extract,
it is most often used with stronger flavors and scents, such
as chocolate or spices like cloves, nutmeg, or cinnamon.
vanillin: InChI=1/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3 ethyl vanillin: InChI=1/C9H10O3/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-6,11H,2H2,1H3